On Target 5HT1E_HUMAN 0.14615385/CHEMBL29410
For the given ligand MM-24, we have found in our database that, being scored 0.14615385, the most similar ligand is CHEMBL29410. Check out the elaboration below.
| MM-24 (Given Ligand) | CHEMBL29410 (Similar Ligand) |
|---|---|
| Cc2occ(OC1OC(C)C(O)C(O)C1O)c(=O)c2OC3OC(C)C(O)C(O)C3O | COc1ccc(NS(=O)(=O)c2sc3ccc(Cl)cc3c2C)cc1N4CCN5CCCCC5C4 |
|
|
|
|
|
|
| 0c000001 01200008 20080108 01010300 803d104c 82000800 40042800 00000000 02224110 01000060 40000090 40008010 40808400 02800088 11200020 002ab008 00804000 22008005 1348a000 00025003 00140020 08000408 05000000 0a580010 00400400 80000000 04020034 2c900020 01052300 01820211 01e00000 00b50008 | 0001c012 11800008 21100b2a 04b90600 a0181000 00402010 06020000 20000008 00000040 00408ac0 04202204 70018880 0204160e 00022001 813a11c1 00024408 00042088 02002400 08c02000 00026201 c0100000 78000998 200400e1 0b50821a 00882080 a4102000 20040400 1001008c 08808604 20060000 00000c00 00c30660 |