On Target DRD1_HUMAN 0.23831776/CHEMBL182379
For the given ligand MM-24, we have found in our database that, being scored 0.23831776, the most similar ligand is CHEMBL182379. Check out the elaboration below.
| MM-24 (Given Ligand) | CHEMBL182379 (Similar Ligand) |
|---|---|
| Cc2occ(OC1OC(C)C(O)C(O)C1O)c(=O)c2OC3OC(C)C(O)C(O)C3O | COc1ccccc1N2CCN(CCCCNC(=O)c3oc4ccc(I)cc4c3)CC2 |
|
|
|
|
|
|
| 0c000001 01200008 20080108 01010300 803d104c 82000800 40042800 00000000 02224110 01000060 40000090 40008010 40808400 02800088 11200020 002ab008 00804000 22008005 1348a000 00025003 00140020 08000408 05000000 0a580010 00400400 80000000 04020034 2c900020 01052300 01820211 01e00000 00b50008 | 00014082 00201808 20580128 04010600 84001200 00000000 02000000 62201200 02204100 00000ac0 00200034 40029000 44008d4a 02002088 01000461 00004018 00044000 02000000 08000100 00020201 40110040 38068608 20000021 0248821e 08800020 e0000000 24100014 98000080 0800a380 01060001 a0240800 00000200 |