On Target DRD4_HUMAN 0.26605505/CHEMBL196476
For the given ligand MM-24, we have found in our database that, being scored 0.26605505, the most similar ligand is CHEMBL196476. Check out the elaboration below.
| MM-24 (Given Ligand) | CHEMBL196476 (Similar Ligand) |
|---|---|
| Cc2occ(OC1OC(C)C(O)C(O)C1O)c(=O)c2OC3OC(C)C(O)C(O)C3O | COc1cccc2cc(oc12)C(=O)NCCCCN3CCN(CC3)c4cccc(Cl)c4Cl |
|
|
|
|
|
|
| 0c000001 01200008 20080108 01010300 803d104c 82000800 40042800 00000000 02224110 01000060 40000090 40008010 40808400 02800088 11200020 002ab008 00804000 22008005 1348a000 00025003 00140020 08000408 05000000 0a580010 00400400 80000000 04020034 2c900020 01052300 01820211 01e00000 00b50008 | 0801c082 00201808 20180128 05010600 04011204 01000000 0a000000 6a201200 02224100 00000ac0 00200034 40029800 46008c0e 00002089 01000461 00000008 00044000 12000001 08000000 00024203 40100000 38068708 20000021 0249021e 08c02020 e0100400 04100014 98000080 0800a380 01060011 a0040000 00020200 |