On Target HRH4_HUMAN 0.2044199/CHEMBL1934062
For the given ligand MM-24, we have found in our database that, being scored 0.2044199, the most similar ligand is CHEMBL1934062. Check out the elaboration below.
| MM-24 (Given Ligand) | CHEMBL1934062 (Similar Ligand) |
|---|---|
| Cc2occ(OC1OC(C)C(O)C(O)C1O)c(=O)c2OC3OC(C)C(O)C(O)C3O | C[C@H]1CCCN1[C@H](CCCOc2ccccc2)c3ccc(cc3)c4ccc(CN5CCCCC5)cc4 |
|
|
|
|
|
|
| 0c000001 01200008 20080108 01010300 803d104c 82000800 40042800 00000000 02224110 01000060 40000090 40008010 40808400 02800088 11200020 002ab008 00804000 22008005 1348a000 00025003 00140020 08000408 05000000 0a580010 00400400 80000000 04020034 2c900020 01052300 01820211 01e00000 00b50008 | 04002000 01000008 2010010a 00010700 00181000 02000010 02000000 22001000 00000900 000808c0 08300000 50018800 80800802 00200000 11000401 00082008 00820000 02000000 04400000 10020201 00000100 18008000 11000000 00500010 00000000 c0000000 00000200 90000040 00004300 00060002 20040000 00002e00 |