On Target HRH1_HUMAN 0.255/CHEMBL62312
For the given ligand MM-24, we have found in our database that, being scored 0.255, the most similar ligand is CHEMBL62312. Check out the elaboration below.
| MM-24 (Given Ligand) | CHEMBL62312 (Similar Ligand) |
|---|---|
| Cc2occ(OC1OC(C)C(O)C(O)C1O)c(=O)c2OC3OC(C)C(O)C(O)C3O | CCCCCC(=O)c1ccc(OCCCN2CCN(CC2)C(=O)c3occc3)cc1 |
|
|
|
|
|
|
| 0c000001 01200008 20080108 01010300 803d104c 82000800 40042800 00000000 02224110 01000060 40000090 40008010 40808400 02800088 11200020 002ab008 00804000 22008005 1348a000 00025003 00140020 08000408 05000000 0a580010 00400400 80000000 04020034 2c900020 01052300 01820211 01e00000 00b50008 | 04010080 01202808 2018010b 04010600 04001000 02000000 02040000 02201008 02004900 00090840 08300030 40009000 44808c1a 00202008 01000421 00082008 00204000 02000000 00802000 00020201 00000100 38068600 010000a1 0248021c 00800021 e0000000 04120010 88000000 08000382 00060003 80020000 00000640 |