On Target 5HT7R_HUMAN 0.22580644/CHEMBL2401935
For the given ligand MM-24, we have found in our database that, being scored 0.22580644, the most similar ligand is CHEMBL2401935. Check out the elaboration below.
| MM-24 (Given Ligand) | CHEMBL2401935 (Similar Ligand) |
|---|---|
| Cc2occ(OC1OC(C)C(O)C(O)C1O)c(=O)c2OC3OC(C)C(O)C(O)C3O | Cl.COc1ccccc1N2CCN(Cc3ccc4Oc5ccccc5C(=O)c4c3)CC2 |
|
|
|
|
|
|
| 0c000001 01200008 20080108 01010300 803d104c 82000800 40042800 00000000 02224110 01000060 40000090 40008010 40808400 02800088 11200020 002ab008 00804000 22008005 1348a000 00025003 00140020 08000408 05000000 0a580010 00400400 80000000 04020034 2c900020 01052300 01820211 01e00000 00b50008 | 00004002 00200008 20080128 04010600 80001200 80000020 02000000 42001200 02004000 40010a40 00200024 40008000 40008c02 00202088 01000441 00004008 00040000 02000000 08000000 00020000 40100000 2a008008 20004020 02588002 08000020 c0000002 20000010 88100080 0800a300 01860000 00040800 00020200 |