On Target MC5R_HUMAN 0.18061674/CHEMBL3935253
For the given ligand MM-24, we have found in our database that, being scored 0.18061674, the most similar ligand is CHEMBL3935253. Check out the elaboration below.
| MM-24 (Given Ligand) | CHEMBL3935253 (Similar Ligand) |
|---|---|
| Cc2occ(OC1OC(C)C(O)C(O)C1O)c(=O)c2OC3OC(C)C(O)C(O)C3O | NC(=N)NCCC[C@@H]1N[C@H](CNC(=O)c2ccc3OCOc3c2)CCN(CC(c4ccccc4)c5ccccc5)C1=O |
|
|
|
|
|
|
| 0c000001 01200008 20080108 01010300 803d104c 82000800 40042800 00000000 02224110 01000060 40000090 40008010 40808400 02800088 11200020 002ab008 00804000 22008005 1348a000 00025003 00140020 08000408 05000000 0a580010 00400400 80000000 04020034 2c900020 01052300 01820211 01e00000 00b50008 | 00010000 45003c08 20100109 04010e00 00001000 00000000 02040000 2300300c 00200280 000909e2 48200000 4003b000 0600d812 20002001 81004401 20308008 00000000 02000000 00080000 00020201 08040200 382f8620 00000003 8354801c 40000000 e0000000 40220000 f0000000 0d000390 00060013 a00c4000 00012600 |