On Target 5HT1D_HUMAN 0.13978495/CHEMBL110318
For the given ligand ZJH-P, we have found in our database that, being scored 0.13978495, the most similar ligand is CHEMBL110318. Check out the elaboration below.
| ZJH-P (Given Ligand) | CHEMBL110318 (Similar Ligand) |
|---|---|
| C=C(C)C4CC[C@]5(C)CC[C@]3(C)C(CCC2[C@@]1(C)CC[C@H](O)[C@](C)(C)C1CC[C@]23C)C45 | NCCc1c[nH]c2ccc(OCCCCC3CCCCC3)cc12 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00800000 00000400 00080008 00000000 00000000 02402000 00000001 00000000 00000000 01000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 24020000 00000000 | 04000002 01000808 20000108 41010710 000c1000 02000000 060c2000 00000000 00400000 00090840 08000004 40008000 10800806 00c00000 11000041 000c200c 00800000 02000000 02602400 00020001 40000000 18008008 21800000 81400010 00042000 80000000 08120000 00000000 04000200 00060002 00060200 00000420 |