On Target GASR_HUMAN 0.1588785/CHEMBL31093
For the given ligand ZJH-P, we have found in our database that, being scored 0.1588785, the most similar ligand is CHEMBL31093. Check out the elaboration below.
| ZJH-P (Given Ligand) | CHEMBL31093 (Similar Ligand) |
|---|---|
| C=C(C)C4CC[C@]5(C)CC[C@]3(C)C(CCC2[C@@]1(C)CC[C@H](O)[C@](C)(C)C1CC[C@]23C)C45 | OC(=O)[C@@H](CC1CCCCC1)NC(=O)CCC(NC(=O)c2cc(Cl)cc(Cl)c2)C(=O)N3CCC4(CCCC4)CC3 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00800000 00000400 00080008 00000000 00000000 02402000 00000001 00000000 00000000 01000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 24020000 00000000 | 00038000 09007800 00100100 04010600 00080080 00000020 04000000 22001008 00200000 000308c8 00200000 5003b800 0600881e 00802400 80080400 00080008 10000000 02000000 02402000 00000201 00000000 38068f30 03000001 0250001c 00002000 c0000000 00000000 90000000 08000100 01060801 a0064000 00822200 |