On Target ADRB3_HUMAN 0.14018692/CHEMBL3747487
For the given ligand ZJH-P, we have found in our database that, being scored 0.14018692, the most similar ligand is CHEMBL3747487. Check out the elaboration below.
| ZJH-P (Given Ligand) | CHEMBL3747487 (Similar Ligand) |
|---|---|
| C=C(C)C4CC[C@]5(C)CC[C@]3(C)C(CCC2[C@@]1(C)CC[C@H](O)[C@](C)(C)C1CC[C@]23C)C45 | CCOC(=O)C1CCN(CC1)C(=O)c2ccc(C[C@@H]3CC[C@@H](N3)[C@H](O)c4ccccc4)cc2 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00800000 00000400 00080008 00000000 00000000 02402000 00000001 00000000 00000000 01000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 24020000 00000000 | 00020000 01001800 00100102 40010700 00180080 00004010 00000000 22001000 00000980 000808c0 08300000 50019800 84008802 01a00000 00080400 00081008 10020000 02000000 00402000 00000201 00000120 18268e30 03000000 8150001c 00000400 c0000000 00000200 90000000 04000302 00060003 e0060000 00802e00 |