On Target OPRK_HUMAN 0.296875/CHEMBL2022306
For the given ligand ZJH-P, we have found in our database that, being scored 0.296875, the most similar ligand is CHEMBL2022306. Check out the elaboration below.
| ZJH-P (Given Ligand) | CHEMBL2022306 (Similar Ligand) |
|---|---|
| C=C(C)C4CC[C@]5(C)CC[C@]3(C)C(CCC2[C@@]1(C)CC[C@H](O)[C@](C)(C)C1CC[C@]23C)C45 | COC(=O)[C@@H]1C[C@H](OC(=O)C)C(=O)[C@H]2[C@@]1(C)CC[C@H]3C(=O)O[C@@H](C[C@]23C)C(=O)\C=C/C |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00800000 00000400 00080008 00000000 00000000 02402000 00000001 00000000 00000000 01000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 24020000 00000000 | 00050040 01000000 00000100 00010300 80280000 00000000 00000000 00000400 01000000 00120000 00000200 4000d000 04028028 00800000 00000404 08081008 00820000 80000100 12412000 00008001 00000020 00001a00 0100a000 00000014 00000400 00000000 00406000 80000000 00000200 00000002 24020000 02000000 |