On Target ADRB1_HUMAN 0.123595506/CHEMBL1263
For the given ligand ZJH-P, we have found in our database that, being scored 0.123595506, the most similar ligand is CHEMBL1263. Check out the elaboration below.
| ZJH-P (Given Ligand) | CHEMBL1263 (Similar Ligand) |
|---|---|
| C=C(C)C4CC[C@]5(C)CC[C@]3(C)C(CCC2[C@@]1(C)CC[C@H](O)[C@](C)(C)C1CC[C@]23C)C45 | OCc1cc(ccc1O)C(O)CNCCCCCCOCCCCc2ccccc2 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00800000 00000400 00080008 00000000 00000000 02402000 00000001 00000000 00000000 01000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 24020000 00000000 | 00000040 01000008 20100102 00010700 00081081 00004000 02000000 20000800 00000980 000808c0 a8300000 40018000 00000002 00a00000 00080000 00083008 10800000 02000000 00402000 40020201 00000120 18200030 03000000 81500010 00000400 80000000 00520000 10000000 04000200 00060002 40000000 00002600 |