On Target DRD1_HUMAN 0.16867469/CHEMBL1779058
For the given ligand ZJH-P, we have found in our database that, being scored 0.16867469, the most similar ligand is CHEMBL1779058. Check out the elaboration below.
| ZJH-P (Given Ligand) | CHEMBL1779058 (Similar Ligand) |
|---|---|
| C=C(C)C4CC[C@]5(C)CC[C@]3(C)C(CCC2[C@@]1(C)CC[C@H](O)[C@](C)(C)C1CC[C@]23C)C45 | OC12C3C4CC5C6C4C1C6C(C35)N2CCCC(=O)c7ccc(F)cc7 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00800000 00000400 00080008 00000000 00000000 02402000 00000001 00000000 00000000 01000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 24020000 00000000 | 00020000 01000800 00100102 02010600 00180000 00008010 00000000 20000000 00100a00 000808c0 08300000 40019000 04008002 00a01010 00200000 00180008 00000000 02000080 02402000 80100201 00000100 18020250 01000000 00500014 00000000 80000000 00000000 10001001 00000000 01068002 80020000 00802e00 |