On Target DRD5_HUMAN 0.12/CHEMBL517244
For the given ligand ZJH-P, we have found in our database that, being scored 0.12, the most similar ligand is CHEMBL517244. Check out the elaboration below.
| ZJH-P (Given Ligand) | CHEMBL517244 (Similar Ligand) |
|---|---|
| C=C(C)C4CC[C@]5(C)CC[C@]3(C)C(CCC2[C@@]1(C)CC[C@H](O)[C@](C)(C)C1CC[C@]23C)C45 | CN(CCCC12CCC(c3ccccc13)c4ccccc24)Cc5ccc(OCCCN6CCCCC6)cc5 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00800000 00000400 00080008 00000000 00000000 02402000 00000001 00000000 00000000 01000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 24020000 00000000 | 04000000 01000008 2010010a 00010600 00001000 02000002 12040400 23001001 00100800 000808c0 08300000 50018000 00800802 00200000 01000421 00082008 00200200 02000000 00902000 00020201 00000100 18008010 01004080 00500010 00000001 e0000001 00220000 d0000000 02000382 00060002 20060000 00002640 |