On Target NPFF1_HUMAN 0.08510638/CHEMBL3361424
For the given ligand ZJH-P, we have found in our database that, being scored 0.08510638, the most similar ligand is CHEMBL3361424. Check out the elaboration below.
| ZJH-P (Given Ligand) | CHEMBL3361424 (Similar Ligand) |
|---|---|
| C=C(C)C4CC[C@]5(C)CC[C@]3(C)C(CCC2[C@@]1(C)CC[C@H](O)[C@](C)(C)C1CC[C@]23C)C45 | NC(=N)NCC(=O)NCC1(CCc2ccccc2)CCN(Cc3ccccc3)CC1 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00800000 00000400 00080008 00000000 00000000 02402000 00000001 00000000 00000000 01000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 24020000 00000000 | 00000000 01001000 00100102 04010e00 00000000 00000000 00000000 22003000 00300c40 000808c2 08300000 5003a000 0400a802 00202000 00000400 00100000 00010010 02000000 00002000 00000201 00000100 38058610 00000001 02500018 00000000 c0000000 40000000 90000000 08000112 00060003 20044000 00000600 |