On Target 5HT1B_HUMAN 0.15053764/CHEMBL2205816
For the given ligand ZJH-P, we have found in our database that, being scored 0.15053764, the most similar ligand is CHEMBL2205816. Check out the elaboration below.
| ZJH-P (Given Ligand) | CHEMBL2205816 (Similar Ligand) |
|---|---|
| C=C(C)C4CC[C@]5(C)CC[C@]3(C)C(CCC2[C@@]1(C)CC[C@H](O)[C@](C)(C)C1CC[C@]23C)C45 | OC12C3C4CC5C6C4C1C6C(C35)N2CCc7ccccn7 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00800000 00000400 00080008 00000000 00000000 02402000 00000001 00000000 00000000 01000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 24020000 00000000 | 0400000a 01000000 00104120 10000600 001c0020 00008010 00000000 20000000 00c00280 000802c0 08208004 40810000 00000802 00800010 01020000 021c000c 00000000 0a000000 02602000 80000201 40000000 18208050 21800000 81500010 00001000 80000000 00000040 10001000 04000004 01060002 80020000 20002e00 |