On Target OPRD_HUMAN 0.21666667/CHEMBL3326796
For the given ligand ZJH-P, we have found in our database that, being scored 0.21666667, the most similar ligand is CHEMBL3326796. Check out the elaboration below.
| ZJH-P (Given Ligand) | CHEMBL3326796 (Similar Ligand) |
|---|---|
| C=C(C)C4CC[C@]5(C)CC[C@]3(C)C(CCC2[C@@]1(C)CC[C@H](O)[C@](C)(C)C1CC[C@]23C)C45 | C[C@H]1CN(CC[C@H](O)C2CCCCC2)CC[C@@]1(C)c3ccccc3 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00800000 00000400 00080008 00000000 00000000 02402000 00000001 00000000 00000000 01000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 24020000 00000000 | 00000000 01000200 00100100 00010600 00080000 00000000 00000000 20000000 00000800 000808c0 08300000 50018000 00000002 00800000 00000000 000c0008 00000000 02000000 02c02000 00000201 00000100 18000010 01000080 00500010 00000001 80000000 00000000 10000000 00000000 0006000a 00020000 00002600 |