On Target 5HT4R_HUMAN 0.1682243/CHEMBL555447
For the given ligand ZJH-P, we have found in our database that, being scored 0.1682243, the most similar ligand is CHEMBL555447. Check out the elaboration below.
| ZJH-P (Given Ligand) | CHEMBL555447 (Similar Ligand) |
|---|---|
| C=C(C)C4CC[C@]5(C)CC[C@]3(C)C(CCC2[C@@]1(C)CC[C@H](O)[C@](C)(C)C1CC[C@]23C)C45 | COc1cc(N)c(Cl)cc1C(=O)NC2CCN(CCCCCCCCO)CC2 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00800000 00000400 00080008 00000000 00000000 02402000 00000001 00000000 00000000 01000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 24020000 00000000 | 00008002 89001c08 20100108 80010600 00081000 00020100 06000000 22001400 00000000 001009e8 08200004 50018800 02008806 08800000 81000441 00082008 00000000 02000400 00402000 00020601 40000000 180a8710 21000000 0050001c 00002000 c0000400 00100800 90000000 00000300 00060811 a4060000 00022200 |