On Target GABR1_HUMAN 0.17266187/CHEMBL2391908
For the given ligand ttt, we have found in our database that, being scored 0.17266187, the most similar ligand is CHEMBL2391908. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL2391908 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | Cl.C[C@H](NC[C@H](O)CP(=O)(O)CC1CCCCC1)c2ccc(Cl)c(Cl)c2 |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00008008 0d000200 00100100 00010600 00000080 80000000 04000000 02001000 00000400 00080848 08200001 40108800 02000876 01060000 8e000400 00080008 1000002c 02300000 02006000 00000201 00000000 19108100 03400000 00480010 08002000 c0100000 00040000 80014000 00140b00 00060302 70060000 0102d601 |