On Target GASR_HUMAN 0.3966942/CHEMBL289008
For the given ligand ttt, we have found in our database that, being scored 0.3966942, the most similar ligand is CHEMBL289008. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL289008 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | OC(=O)C[C@@H](NC(=O)CCC(NC(=O)c1cc(Cl)cc(Cl)c1)C(=O)N2CCC3(CCCC3)CC2)C(=O)N4CCC5(CCCC5)CC4 |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00078000 09003800 00100100 04010600 00100000 00000020 04000000 22001008 00200000 000308c8 00200000 5003b800 0e008816 00002400 80000400 00080008 00000000 02000001 00c02010 00000201 00000000 38168f30 01000081 0250001c 00003001 c0000000 00000000 90000000 08000102 01060801 a0064000 00822a00 |