On Target MSHR_HUMAN 0.30714285/CHEMBL2310901
For the given ligand ttt, we have found in our database that, being scored 0.30714285, the most similar ligand is CHEMBL2310901. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL2310901 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | CCCC[C@H](NC(=O)[C@@H](NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(C)C)C(=O)NCC(=O)N2CCC[C@H]2C(=O)N[C@@H](Cc3ccccc3)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@H](Cc4ccc5ccccc5c4)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](Cc6ccccc6)C(=O)NCC(=O)O |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00070000 01007208 20100100 04010e00 00100082 00000010 02010000 2000000c 00200880 000808c2 08300010 4003b000 0e00801a 00002009 80180000 000c0008 10000800 02000001 00c02018 00020201 00000100 38340e38 03000083 83500018 00001801 80000000 40130000 10000000 0c000002 0006000b 20004000 00802e00 |