On Target 5HT1F_HUMAN 0.20512821/CHEMBL418806
For the given ligand ttt, we have found in our database that, being scored 0.20512821, the most similar ligand is CHEMBL418806. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL418806 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | CN1CCC(CC1)c2c[nH]c3ccc(NC(=O)C4CCCCC4)nc23 |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00014002 01800a00 00184180 40810610 200c1240 00002000 0000a000 20100000 00400800 200800c0 08380004 5001b000 0c00880a 00500800 00060840 00040004 08040000 02004008 0a602400 00a00205 40100100 5c008618 21802840 80700010 00042000 80000000 08008080 10000084 00008008 0006180b 00061200 00000720 |