On Target NPBW1_HUMAN 0.21714285/CHEMBL1940539
For the given ligand ttt, we have found in our database that, being scored 0.21714285, the most similar ligand is CHEMBL1940539. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL1940539 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | COc1ccc(cc1)C2(CCC2)N[C@@H]3CC[C@@H]([C@H](C3)c4ccsc4)C(=O)N5CCN(CC5)c6nc7ccccc7[nH]6 |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00010002 01002208 2010090a 85010600 00141040 00004000 02040000 22001008 00000900 200808c0 09308204 40019080 0400881a 00603011 01001441 001c000c 00000000 02004000 02202008 00a24601 40000100 7e8086b0 21800821 32700018 00004800 c4000000 00320000 90000004 0800031a 0046180b 60069000 00c12e80 |