On Target CLTR1_HUMAN 0.24117647/CHEMBL3342957
For the given ligand ttt, we have found in our database that, being scored 0.24117647, the most similar ligand is CHEMBL3342957. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL3342957 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | OC(=O)CCCCCN1CC(Oc2c(NC(=O)c3ccc(OCCCCc4ccccc4)cc3)cccc12)C(=O)O |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 04016002 01000808 2010110b 00010702 a8081080 02002000 02040800 22001000 00020820 000808c0 083c0004 5001d000 0c80880a 00b00000 112a1041 00086408 10840000 86000000 08c02010 00020201 41100100 18068e10 37412080 08508014 00081001 80100000 28220448 90800081 00808300 00060003 80040400 00002600 |