On Target 5HT1E_HUMAN 0.17901234/CHEMBL22744
For the given ligand ttt, we have found in our database that, being scored 0.17901234, the most similar ligand is CHEMBL22744. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL22744 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | NC(=O)c1ccc2[nH]cc(C3=CCC(CC3)NCCCCCCCNC4CCC(=CC4)c5c[nH]c6ccc(cc56)C(=O)N)c2c1 |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00000002 09008800 00100302 42810610 00041104 00000000 80082080 20001402 10500900 001828c8 08300004 41018800 88028802 00600800 00000442 00440004 00004400 02000064 00222400 00000203 41000100 1a068618 20808020 80500014 01042000 80000000 88406040 d0000000 04400002 00060c02 84060200 00002620 |