On Target ADA2C_HUMAN 0.4/CHEMBL191703
For the given ligand ttt, we have found in our database that, being scored 0.4, the most similar ligand is CHEMBL191703. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL191703 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | C[C@H]1[C@H]2CC[C@H]3[C@@H]4CC=C5C[C@H](CC[C@]5(C)[C@H]4CC[C@]23CN1C)N(C)C |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00000000 09000000 00100000 00000400 00000000 00000010 00080000 20000402 00000000 00100080 00200000 41010000 00020002 00000000 00000400 00000000 00000000 00000060 02012000 00000201 00000000 10000010 00008000 00100010 00200000 00000000 00404000 90000000 00000000 01040400 24020000 00002200 |