On Target NPFF1_HUMAN 0.26717559/CHEMBL1672379
For the given ligand ttt, we have found in our database that, being scored 0.26717559, the most similar ligand is CHEMBL1672379. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL1672379 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | CC(C)C[C@H](NC(=O)[C@@H](N)CO)C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc2ccccc2)C(=O)O |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00030000 01007000 00100100 04010e00 00000080 00000010 00000000 2000200c 00200a80 000a08c2 08300000 4003b000 16009012 00002001 80180000 00180008 10000000 02000000 00c00008 00000201 00000100 38250e20 030000c3 83500018 00000801 80000000 40000000 10000000 0c000010 00060003 a0084000 00802600 |