On Target AA3R_HUMAN 0.5769231/CHEMBL275040
For the given ligand ttt, we have found in our database that, being scored 0.5769231, the most similar ligand is CHEMBL275040. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL275040 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | CC(=C)[C@H]1CN[C@@H]([C@H]1CC(=O)O)C(=O)O |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00030000 09000000 00100000 00000400 00180080 00000010 00080000 20000400 10000000 00128088 00200000 40013000 0600803a 03800000 80080400 00080008 10004000 00000000 00402000 00000201 00000000 10000a00 03000000 00100010 00000000 00000000 00000000 90000000 00000000 00040000 04004000 00802a00 |