On Target 5HT6R_HUMAN 0.28985506/CHEMBL98511
For the given ligand ttt, we have found in our database that, being scored 0.28985506, the most similar ligand is CHEMBL98511. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL98511 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | C1CCN2CCNCC2C1 |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00000000 01000000 00100000 04000400 00000000 00000000 00000000 20000000 00000000 00000080 00200000 50010000 00000002 00002000 00000000 00000000 00000000 00000000 00002000 00000201 00000000 30000010 00000021 02100010 00000000 00000000 00000000 10000000 08000000 00040000 00000000 00000200 |