On Target 5HT7R_HUMAN 0.46835443/CHEMBL485803
For the given ligand ttt, we have found in our database that, being scored 0.46835443, the most similar ligand is CHEMBL485803. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL485803 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | NC(=N)N1CCCC1CC(=O)O |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00010000 01000000 00100000 00000c00 00080000 00000010 00000000 00002000 00000200 00000082 00200000 40011000 0c00900a 00800000 00000000 00180008 00000000 00000000 00c02010 00000201 00000000 12012a10 01000080 00100010 00003003 00000000 40000000 10000000 00000010 00040000 80080000 00002200 |