On Target GRM6_HUMAN 0.21167883/CHEMBL275079
For the given ligand Y-1, we have found in our database that, being scored 0.21167883, the most similar ligand is CHEMBL275079. Check out the elaboration below.
| Y-1 (Given Ligand) | CHEMBL275079 (Similar Ligand) |
|---|---|
| O=c1ccocc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O | N[C@]1(CO[C@H]2[C@@H]([C@@H]12)C(=O)O)C(=O)O |
|
|
|
|
|
|
| 0c000000 01200008 20080008 01010300 803d104c 82000800 00042800 00000000 02224000 01000060 40000080 40008000 40808400 02800088 11200000 002ab008 00800000 00000000 1148a000 00025003 00140020 08000400 05000000 0a180010 00400400 00000000 00000010 2c900020 01002200 01820201 01e00000 00b50000 | 00070040 01000000 00000000 80010500 803c0040 00200000 00000000 00000000 00000000 01020080 00000000 4001b000 14008038 03800000 00081000 00081008 00a00000 00000100 11c02000 00000001 00000020 10000a00 03000000 00000010 10000400 00000000 00000200 00000000 00000200 00040000 00000000 00000000 |