On Target OPRM_HUMAN 0.3/CHEMBL4113162
For the given ligand Y-1, we have found in our database that, being scored 0.3, the most similar ligand is CHEMBL4113162. Check out the elaboration below.
| Y-1 (Given Ligand) | CHEMBL4113162 (Similar Ligand) |
|---|---|
| O=c1ccocc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O | CCC1O[C@]23CC[C@@]4(C[C@@H]2[C@](C)(O1)C(C)(C)C)[C@H]5Cc6ccc(O)c7O[C@@H]3[C@]4(CCN5CC8CC8)c67 |
|
|
|
|
|
|
| 0c000000 01200008 20080008 01010300 803d104c 82000800 00042800 00000000 02224000 01000060 40000080 40008000 40808400 02800088 11200000 002ab008 00800000 00000000 1148a000 00025003 00140020 08000400 05000000 0a180010 00400400 00000000 00000010 2c900020 01002200 01820201 01e00000 00b50000 | 04001040 43000208 2010050a 00a10700 00381061 c2000002 02803800 28000241 00202890 010818e0 08300000 50818040 00804002 21a00080 11240021 022cb018 08800200 22008000 1748a002 00020201 00100120 18200010 05004040 89500410 00000400 c0000001 00120200 34800020 04000302 0007c80a 00220000 00002f40 |