On Target NPSR1_HUMAN 0.1754386/CHEMBL3085788
For the given ligand Y-1, we have found in our database that, being scored 0.1754386, the most similar ligand is CHEMBL3085788. Check out the elaboration below.
| Y-1 (Given Ligand) | CHEMBL3085788 (Similar Ligand) |
|---|---|
| O=c1ccocc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O | COc1ccc(cc1OC)C2C3C(Oc4ccc5ccccc5c24)N=CN(CCN6CCOCC6)C3=N |
|
|
|
|
|
|
| 0c000000 01200008 20080008 01010300 803d104c 82000800 00042800 00000000 02224000 01000060 40000080 40008000 40808400 02800088 11200000 002ab008 00800000 00000000 1148a000 00025003 00140020 08000400 05000000 0a180010 00400400 00000000 00000010 2c900020 01002200 01820201 01e00000 00b50000 | 04000040 62210618 20100108 84011f00 00089080 c2200000 02050000 21002200 04000e00 000a09c3 18310010 40208042 40844402 20802008 11101009 001ca188 10210800 22008000 00d82000 00020201 02002100 38002008 130020c1 02420411 00000401 e8010003 48130000 50080001 0a200390 1006801a 82002000 10040640 |