On Target ADRB3_HUMAN 0.23041475/CHEMBL306233
For the given ligand Y-1, we have found in our database that, being scored 0.23041475, the most similar ligand is CHEMBL306233. Check out the elaboration below.
| Y-1 (Given Ligand) | CHEMBL306233 (Similar Ligand) |
|---|---|
| O=c1ccocc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O | O[C@@H](CNC1CCN(CC1)S(=O)(=O)c2ccc3oc4ccccc4c3c2)COc5cccc6[nH]c(O)nc56 |
|
|
|
|
|
|
| 0c000000 01200008 20080008 01010300 803d104c 82000800 00042800 00000000 02224000 01000060 40000080 40008000 40808400 02800088 11200000 002ab008 00800000 00000000 1148a000 00025003 00140020 08000400 05000000 0a180010 00400400 00000000 00000010 2c900020 01002200 01820201 01e00000 00b50000 | 04000012 03a00418 61180108 01b10600 000c12c0 06004004 16000001 40200228 00004100 004009e0 0120a004 70058000 40800402 08400181 e1e80145 000c200c 10202000 08000008 00e00000 00067603 c0020000 18000028 27800080 18480018 0a000801 0000020c 00000210 1980800c 04002600 21460010 40000000 042122f0 |