On Target ACM4_HUMAN 0.2460733/CHEMBL1223862
For the given ligand Y-1, we have found in our database that, being scored 0.2460733, the most similar ligand is CHEMBL1223862. Check out the elaboration below.
| Y-1 (Given Ligand) | CHEMBL1223862 (Similar Ligand) |
|---|---|
| O=c1ccocc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O | CCO[C@@H]1CC[C@](C)(CC1)N2CCC(CC2)N3C(=O)Oc4ccc(OC)cc34 |
|
|
|
|
|
|
| 0c000000 01200008 20080008 01010300 803d104c 82000800 00042800 00000000 02224000 01000060 40000080 40008000 40808400 02800088 11200000 002ab008 00800000 00000000 1148a000 00025003 00140020 08000400 05000000 0a180010 00400400 00000000 00000010 2c900020 01002200 01820201 01e00000 00b50000 | 00000002 01000408 20180008 00010700 001c1e10 00400080 06000400 a0000608 04284020 800009f0 04200084 50c1a000 c0008406 01e40100 01100041 000c100c 00900000 40000000 02602080 50060201 40000020 18000010 21800018 04380010 10000440 40000000 00000630 18000040 02006200 03060210 00160000 00202a00 |