On Target TAAR1_HUMAN 0.24475524/CHEMBL3652684
For the given ligand Y-1, we have found in our database that, being scored 0.24475524, the most similar ligand is CHEMBL3652684. Check out the elaboration below.
| Y-1 (Given Ligand) | CHEMBL3652684 (Similar Ligand) |
|---|---|
| O=c1ccocc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O | NC1=N[C@@H](CCOc2ccccc2)CO1 |
|
|
|
|
|
|
| 0c000000 01200008 20080008 01010300 803d104c 82000800 00042800 00000000 02224000 01000060 40000080 40008000 40808400 02800088 11200000 002ab008 00800000 00000000 1148a000 00025003 00140020 08000400 05000000 0a180010 00400400 00000000 00000010 2c900020 01002200 01820201 01e00000 00b50000 | 04000000 00480008 20000008 00010700 00201020 02000000 02010840 80000000 00000000 00000862 00000010 40808001 00800002 00000308 11001001 80382008 00200800 00000020 10c00000 000a0001 00000000 38000000 03080000 00000010 00000000 00000002 40000000 20000020 0c000200 00060000 00000000 00c00040 |