On Target OPRK_HUMAN 0.33082706/CHEMBL560302
For the given ligand Y-1, we have found in our database that, being scored 0.33082706, the most similar ligand is CHEMBL560302. Check out the elaboration below.
| Y-1 (Given Ligand) | CHEMBL560302 (Similar Ligand) |
|---|---|
| O=c1ccocc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O | CO[C@H]1O[C@@H](OC)[C@](O)([C@@H]1O)[C@@H]2C[C@@]3(C)[C@@H](CC[C@@]4(C)[C@@H](C[C@H](OC(=O)C)C(=O)[C@H]34)C(=O)OC)C(=O)O2 |
|
|
|
|
|
|
| 0c000000 01200008 20080008 01010300 803d104c 82000800 00042800 00000000 02224000 01000060 40000080 40008000 40808400 02800088 11200000 002ab008 00800000 00000000 1148a000 00025003 00140020 08000400 05000000 0a180010 00400400 00000000 00000010 2c900020 01002200 01820201 01e00000 00b50000 | 00050040 01000000 00000500 00010300 80280040 00000000 00002800 00000000 00200000 010200a0 00000000 4001d000 04008028 00800000 00080000 002a9008 00820000 80000100 1340a000 00000001 00100020 10000a00 05000000 08100014 00000400 00000000 00000000 24000020 00000200 0000000a 00a20000 02000000 |