On Target AA1R_HUMAN 0.26923078/CHEMBL1990267
For the given ligand Y-1, we have found in our database that, being scored 0.26923078, the most similar ligand is CHEMBL1990267. Check out the elaboration below.
| Y-1 (Given Ligand) | CHEMBL1990267 (Similar Ligand) |
|---|---|
| O=c1ccocc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O | COc1cccc2C=C(C(=O)N)C(=N)Oc12 |
|
|
|
|
|
|
| 0c000000 01200008 20080008 01010300 803d104c 82000800 00042800 00000000 02224000 01000060 40000080 40008000 40808400 02800088 11200000 002ab008 00800000 00000000 1148a000 00025003 00140020 08000400 05000000 0a180010 00400400 00000000 00000010 2c900020 01002200 01820201 01e00000 00b50000 | 08000000 00200808 30080108 00010620 00011245 00200100 02010000 40001200 00024000 00000840 00000020 40008400 40008c03 00000080 01042041 20000008 08000000 02010000 00080000 00020202 00000000 0a06860a 01000000 00480004 08402024 80004000 40000010 28900000 01082200 01060000 80040000 00010000 |