On Target CXCR3_HUMAN 0.22279793/CHEMBL3956593
For the given ligand Y-1, we have found in our database that, being scored 0.22279793, the most similar ligand is CHEMBL3956593. Check out the elaboration below.
| Y-1 (Given Ligand) | CHEMBL3956593 (Similar Ligand) |
|---|---|
| O=c1ccocc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O | CCOC(=O)C1CCC(CN(Cc2ccc(OCCN3C(=O)CCC3=O)c(OC)c2)C(C)c4ccc5OCCc5c4)CC1 |
|
|
|
|
|
|
| 0c000000 01200008 20080008 01010300 803d104c 82000800 00042800 00000000 02224000 01000060 40000080 40008000 40808400 02800088 11200000 002ab008 00800000 00000000 1148a000 00025003 00140020 08000400 05000000 0a180010 00400400 00000000 00000010 2c900020 01002200 01820201 01e00000 00b50000 | 04033000 45005008 20100108 00210702 000810c1 02000010 12040000 22001240 00000000 000808c0 08200000 40019000 0480c80a 00800000 010c1401 0208b018 18822000 02000000 06482400 00020201 00020020 18048e10 13000000 00548018 00000400 c0000000 08b20000 90800005 00000302 0006000b 20060000 00800680 |