On Target MSHR_HUMAN 0.17040358/CHEMBL1682208
For the given ligand Y-1, we have found in our database that, being scored 0.17040358, the most similar ligand is CHEMBL1682208. Check out the elaboration below.
| Y-1 (Given Ligand) | CHEMBL1682208 (Similar Ligand) |
|---|---|
| O=c1ccocc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O | COCC(=O)N[C@H]1Cc2cc3COCOc3c(Cc4ccc(Oc5cccc(CN(CCCN6CCN(CCCN)CC6)C1=O)c5)cc4)c2 |
|
|
|
|
|
|
| 0c000000 01200008 20080008 01010300 803d104c 82000800 00042800 00000000 02224000 01000060 40000080 40008000 40808400 02800088 11200000 002ab008 00800000 00000000 1148a000 00025003 00140020 08000400 05000000 0a180010 00400400 00000000 00000010 2c900020 01002200 01820201 01e00000 00b50000 | 00000000 44803608 20100108 04010600 08001081 00004800 02040000 23001a0c 00200980 000909e0 6c300000 4000f210 06008802 00012002 01181401 022c2008 10000800 82000000 00082008 40020301 80440100 38288620 13000021 83448018 00000800 e0402000 00120000 f4a00001 0d000380 0006001b 62044404 00012608 |