On Target GRM5_HUMAN 0.2039801/CHEMBL426467
For the given ligand Y-1, we have found in our database that, being scored 0.2039801, the most similar ligand is CHEMBL426467. Check out the elaboration below.
| Y-1 (Given Ligand) | CHEMBL426467 (Similar Ligand) |
|---|---|
| O=c1ccocc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O | C1CC(Oc2cccnc2)C=C(C1)C#Cc3ccccn3 |
|
|
|
|
|
|
| 0c000000 01200008 20080008 01010300 803d104c 82000800 00042800 00000000 02224000 01000060 40000080 40008000 40808400 02800088 11200000 002ab008 00800000 00000000 1148a000 00025003 00140020 08000400 05000000 0a180010 00400400 00000000 00000010 2c900020 01002200 01820201 01e00000 00b50000 | 0c000202 01020028 60004908 18091380 004cb020 06000804 00288001 08200502 10000000 00100049 41000084 40048008 82820804 08809000 11060400 020c200c 00800208 02000020 00602014 00020081 40041008 08808000 21808801 8240a011 00203404 80000400 40404240 82800000 00040204 00020240 04020800 00008010 |