On Target CLTR1_HUMAN 0.26180258/CHEMBL1213920
For the given ligand Y-1, we have found in our database that, being scored 0.26180258, the most similar ligand is CHEMBL1213920. Check out the elaboration below.
| Y-1 (Given Ligand) | CHEMBL1213920 (Similar Ligand) |
|---|---|
| O=c1ccocc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O | CCCOC1=C(Oc2c(cc(Br)cc2C1=O)C(=O)O)c3cccc(OCc4ccc5ccccc5n4)c3 |
|
|
|
|
|
|
| 0c000000 01200008 20080008 01010300 803d104c 82000800 00042800 00000000 02224000 01000060 40000080 40008000 40808400 02800088 11200000 002ab008 00800000 00000000 1148a000 00025003 00140020 08000400 05000000 0a180010 00400400 00000000 00000010 2c900020 01002200 01820201 01e00000 00b50000 | 0c406002 40208808 221a4108 10110200 0005122d 82004160 02050000 40802200 42024300 40000840 00080097 c0008400 40808c53 00750088 01020061 420c220c 0406c040 22808800 06280200 00021202 40240000 08128e2a b1804006 80d85114 08400000 80006004 14030074 08900048 00006304 11862201 c1441248 08240000 |