On Target 5HT1E_HUMAN 0.13865547/CHEMBL29410
For the given ligand Y-1, we have found in our database that, being scored 0.13865547, the most similar ligand is CHEMBL29410. Check out the elaboration below.
| Y-1 (Given Ligand) | CHEMBL29410 (Similar Ligand) |
|---|---|
| O=c1ccocc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O | COc1ccc(NS(=O)(=O)c2sc3ccc(Cl)cc3c2C)cc1N4CCN5CCCCC5C4 |
|
|
|
|
|
|
| 0c000000 01200008 20080008 01010300 803d104c 82000800 00042800 00000000 02224000 01000060 40000080 40008000 40808400 02800088 11200000 002ab008 00800000 00000000 1148a000 00025003 00140020 08000400 05000000 0a180010 00400400 00000000 00000010 2c900020 01002200 01820201 01e00000 00b50000 | 0001c012 11800008 21100b2a 04b90600 a0181000 00402010 06020000 20000008 00000040 00408ac0 04202204 70018880 0204160e 00022001 813a11c1 00024408 00042088 02002400 08c02000 00026201 c0100000 78000998 200400e1 0b50821a 00882080 a4102000 20040400 1001008c 08808604 20060000 00000c00 00c30660 |