On Target GRM1_HUMAN 0.19125684/CHEMBL177519
For the given ligand Y-1, we have found in our database that, being scored 0.19125684, the most similar ligand is CHEMBL177519. Check out the elaboration below.
| Y-1 (Given Ligand) | CHEMBL177519 (Similar Ligand) |
|---|---|
| O=c1ccocc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O | CCc1cc2cc(ccc2nc1C)C(=O)C3COc4ccccc4O3 |
|
|
|
|
|
|
| 0c000000 01200008 20080008 01010300 803d104c 82000800 00042800 00000000 02224000 01000060 40000080 40008000 40808400 02800088 11200000 002ab008 00800000 00000000 1148a000 00025003 00140020 08000400 05000000 0a180010 00400400 00000000 00000010 2c900020 01002200 01820201 01e00000 00b50000 | 04001002 00004808 20004108 10210310 00041061 02200000 02002200 00000040 00442800 00080840 08140004 4000d000 1080c802 00600000 11260041 020ca00c 08000000 82000004 04600402 00020001 40000100 08068208 25804060 88400014 00040000 80000000 08000048 00800000 00400204 0002000a 80040000 00000440 |