On Target DRD1_HUMAN 0.20547946/CHEMBL3800636
For the given ligand Y-1, we have found in our database that, being scored 0.20547946, the most similar ligand is CHEMBL3800636. Check out the elaboration below.
| Y-1 (Given Ligand) | CHEMBL3800636 (Similar Ligand) |
|---|---|
| O=c1ccocc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O | COc1cc(CCNCCc2ccc(O)c(O)c2)ccc1OCCCc3ccccc3 |
|
|
|
|
|
|
| 0c000000 01200008 20080008 01010300 803d104c 82000800 00042800 00000000 02224000 01000060 40000080 40008000 40808400 02800088 11200000 002ab008 00800000 00000000 1148a000 00025003 00140020 08000400 05000000 0a180010 00400400 00000000 00000010 2c900020 01002200 01820201 01e00000 00b50000 | 04000000 42000008 20100108 00210700 00001000 82000000 02040000 00000000 00000880 00080840 08300000 40008000 00804002 20000000 11000001 0208a008 00000000 02000000 00480000 00020201 00000100 18200000 01000040 81400010 00000000 80000000 00120000 00000000 04000200 0006000a 00000000 00002640 |