On Target TSHR_HUMAN 0.175/CHEMBL1370580
For the given ligand Y-1, we have found in our database that, being scored 0.175, the most similar ligand is CHEMBL1370580. Check out the elaboration below.
| Y-1 (Given Ligand) | CHEMBL1370580 (Similar Ligand) |
|---|---|
| O=c1ccocc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O | COc1ccc(cc1COc2ccc(NC(=O)C)cc2)C3=Nc4ccccc4C(=O)N3Cc5occc5 |
|
|
|
|
|
|
| 0c000000 01200008 20080008 01010300 803d104c 82000800 00042800 00000000 02224000 01000060 40000080 40008000 40808400 02800088 11200000 002ab008 00800000 00000000 1148a000 00025003 00140020 08000400 05000000 0a180010 00400400 00000000 00000010 2c900020 01002200 01820201 01e00000 00b50000 | 0408c082 00a00208 20180108 10010600 260c1021 00004020 02041800 00283808 86104100 500008e0 0128802c 40019000 43809c22 00f10000 410240e1 020c200c 00044820 0200e000 08680000 40420000 c0100208 18008638 21c83041 81f81001 00000022 c0002100 24160010 08040080 0402c304 00460419 40086804 40000280 |