On Target NPFF1_HUMAN 0.1368421/CHEMBL3361420
For the given ligand Y-1, we have found in our database that, being scored 0.1368421, the most similar ligand is CHEMBL3361420. Check out the elaboration below.
| Y-1 (Given Ligand) | CHEMBL3361420 (Similar Ligand) |
|---|---|
| O=c1ccocc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O | COc1cccc(NC2(CNC(=O)CNC(=N)N)CCN(Cc3ccccc3)CC2)c1 |
|
|
|
|
|
|
| 0c000000 01200008 20080008 01010300 803d104c 82000800 00042800 00000000 02224000 01000060 40000080 40008000 40808400 02800088 11200000 002ab008 00800000 00000000 1148a000 00025003 00140020 08000400 05000000 0a180010 00400400 00000000 00000010 2c900020 01002200 01820201 01e00000 00b50000 | 00004002 81003408 20100128 04010e00 20001000 00000000 02000000 22003008 00200440 00000be2 00200004 5003a000 0400a802 08002000 01020441 00100008 00050090 02000000 08000000 00022601 60100000 38058600 20000003 0250001a 00000000 c0000000 40000000 90000080 08008310 00060011 20044000 00020200 |