On Target 5HT1B_HUMAN 0.22435898/CHEMBL424128
For the given ligand Y-1, we have found in our database that, being scored 0.22435898, the most similar ligand is CHEMBL424128. Check out the elaboration below.
| Y-1 (Given Ligand) | CHEMBL424128 (Similar Ligand) |
|---|---|
| O=c1ccocc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O | NCCc1c[nH]c2ccc(OCCCCCCOc3ccc4[nH]cc(CCN)c4c3)cc12 |
|
|
|
|
|
|
| 0c000000 01200008 20080008 01010300 803d104c 82000800 00042800 00000000 02224000 01000060 40000080 40008000 40808400 02800088 11200000 002ab008 00800000 00000000 1148a000 00025003 00140020 08000400 05000000 0a180010 00400400 00000000 00000010 2c900020 01002200 01820201 01e00000 00b50000 | 04000002 01000808 20000108 41010710 000c1000 02000000 060c2000 00000000 00400000 00090840 08000004 40008000 10800806 00c00000 11000041 000c200c 00800000 02000000 00602400 00020001 40000000 18008008 21800000 81400010 00042000 80000000 08120000 00000000 04000200 00060002 00040200 00000420 |