On Target OPRD_HUMAN 0.2974359/CHEMBL3597150
For the given ligand Y-1, we have found in our database that, being scored 0.2974359, the most similar ligand is CHEMBL3597150. Check out the elaboration below.
| Y-1 (Given Ligand) | CHEMBL3597150 (Similar Ligand) |
|---|---|
| O=c1ccocc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O | CC(C)C[C@H](NC(=O)[C@H](CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)NC(=O)CCCNC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc2ccccc2)NC(=O)CNC(=O)[C@@H](NC(=O)[C@@H](N)Cc3ccc(O)cc3)[C@@H](C)O)C(=O)N |
|
|
|
|
|
|
| 0c000000 01200008 20080008 01010300 803d104c 82000800 00042800 00000000 02224000 01000060 40000080 40008000 40808400 02800088 11200000 002ab008 00800000 00000000 1148a000 00025003 00140020 08000400 05000000 0a180010 00400400 00000000 00000010 2c900020 01002200 01820201 01e00000 00b50000 | 00030040 01007208 20100100 84010700 803c00c0 00200000 02003800 2800000c 00200880 010808e0 08300000 4003b000 16008002 02882001 80181008 002f9008 10a00040 02000000 11c0a008 00020201 00100120 38240600 17000083 8b500018 10000c01 80000000 00920000 34000021 0c000202 0006000b 20e04000 00802600 |