On Target AA3R_HUMAN 0.3220339/CHEMBL76273
For the given ligand Y-1, we have found in our database that, being scored 0.3220339, the most similar ligand is CHEMBL76273. Check out the elaboration below.
| Y-1 (Given Ligand) | CHEMBL76273 (Similar Ligand) |
|---|---|
| O=c1ccocc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O | CCCOC1=C(Oc2cc(OCCC)cc(OCCC)c2C1=O)c3ccccc3 |
|
|
|
|
|
|
| 0c000000 01200008 20080008 01010300 803d104c 82000800 00042800 00000000 02224000 01000060 40000080 40008000 40808400 02800088 11200000 002ab008 00800000 00000000 1148a000 00025003 00140020 08000400 05000000 0a180010 00400400 00000000 00000010 2c900020 01002200 01820201 01e00000 00b50000 | 0c402041 00200008 28080108 00010200 0001120c 82004020 42040000 40802200 020a4100 40000840 00000090 41008000 40808402 00200088 01000021 00082208 00064000 22008844 0e000200 00821a02 00240000 08000428 11200000 00584010 08400000 80000000 140800b5 08100048 10016300 11820a01 40400240 02240000 |